About 7-fluoro-4-(6-methyl-1H-indazol-5-yl)-1H-pyrazolo[4,5-b]indole
7-fluoro-4-(6-methyl-1H-indazol-5-yl)-1H-pyrazolo[4,5-b]indole (PubChem CID 73426428) has the molecular formula C17H12FN5
and a molecular weight of 305.32 g/mol. Its IUPAC name is 7-fluoro-4-(6-methyl-1H-indazol-5-yl)-1H-pyrazolo[4,5-b]indole.
Molecular Properties
| Compound Name | 7-fluoro-4-(6-methyl-1H-indazol-5-yl)-1H-pyrazolo[4,5-b]indole |
| PubChem CID | 73426428 |
| Molecular Formula | C17H12FN5 |
| Molecular Weight | 305.32 g/mol |
| Exact Mass | 305.11 |
| IUPAC Name | 7-fluoro-4-(6-methyl-1H-indazol-5-yl)-1H-pyrazolo[4,5-b]indole |
| SMILES | Cc1cc2[nH]ncc2cc1-n1c2ccc(F)cc2c2[nH]ncc21 |
| InChI | InChI=1S/C17H12FN5/c1-9-4-13-10(7-19-21-13)5-15(9)23-14-3-2-11(18)6-12(14)17-16(23)8-20-22-17/h2-8H,1H3,(H,19,21)(H,20,22) |
| InChIKey | XXKLVEQACZAVIB-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 62.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.32 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-fluoro-4-(6-methyl-1H-indazol-5-yl)-1H-pyrazolo[4,5-b]indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-fluoro-4-(6-methyl-1H-indazol-5-yl)-1H-pyrazolo[4,5-b]indole?
The IUPAC name of 7-fluoro-4-(6-methyl-1H-indazol-5-yl)-1H-pyrazolo[4,5-b]indole (CID 73426428) is 7-fluoro-4-(6-methyl-1H-indazol-5-yl)-1H-pyrazolo[4,5-b]indole.
What is the SMILES notation for 7-fluoro-4-(6-methyl-1H-indazol-5-yl)-1H-pyrazolo[4,5-b]indole?
The canonical SMILES for 7-fluoro-4-(6-methyl-1H-indazol-5-yl)-1H-pyrazolo[4,5-b]indole is Cc1cc2[nH]ncc2cc1-n1c2ccc(F)cc2c2[nH]ncc21.
What is the InChIKey of 7-fluoro-4-(6-methyl-1H-indazol-5-yl)-1H-pyrazolo[4,5-b]indole?
The InChIKey is XXKLVEQACZAVIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H12FN5/c1-9-4-13-10(7-19-21-13)5-15(9)23-14-3-2-11(18)6-12(14)17-16(23)8-20-22-17/h2-8H,1H3,(H,19,21)(H,20,22).
What are the key properties of 7-fluoro-4-(6-methyl-1H-indazol-5-yl)-1H-pyrazolo[4,5-b]indole?
7-fluoro-4-(6-methyl-1H-indazol-5-yl)-1H-pyrazolo[4,5-b]indole has a molecular weight of 305.32 g/mol, XLogP of 3.83, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-fluoro-4-(6-methyl-1H-indazol-5-yl)-1H-pyrazolo[4,5-b]indole is sourced from PubChem (CID 73426428), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).