C32H31Br2N3O2 — CID 73427463
ethyl (2S,4S,6S)-4,6-bis(5-bromo-7-methyl-1H-indol-3-yl)-1-phenylpiperidine-2-carboxylate (PubChem CID 73427463) has the molecular formula C32H31Br2N3O2 and a molecular weight of 649.43 g/mol. Its IUPAC name is ethyl (2S,4S,6S)-4,6-bis(5-bromo-7-methyl-1H-indol-3-yl)-1-phenylpiperidine-2-carboxylate.
| Compound Name | ethyl (2S,4S,6S)-4,6-bis(5-bromo-7-methyl-1H-indol-3-yl)-1-phenylpiperidine-2-carboxylate |
|---|---|
| PubChem CID | 73427463 |
| Molecular Formula | C32H31Br2N3O2 |
| Molecular Weight | 649.43 g/mol |
| Exact Mass | 647.08 |
| IUPAC Name | ethyl (2S,4S,6S)-4,6-bis(5-bromo-7-methyl-1H-indol-3-yl)-1-phenylpiperidine-2-carboxylate |
| SMILES | CCOC(=O)[C@@H]1C[C@@H](c2c[nH]c3c(C)cc(Br)cc23)C[C@@H](c2c[nH]c3c(C)cc(Br)cc23)N1c1ccccc1 |
| InChI | InChI=1S/C32H31Br2N3O2/c1-4-39-32(38)29-13-20(26-16-35-30-18(2)10-21(33)14-24(26)30)12-28(37(29)23-8-6-5-7-9-23)27-17-36-31-19(3)11-22(34)15-25(27)31/h5-11,14-17,20,28-29,35-36H,4,12-13H2,1-3H3/t20-,28-,29-/m0/s1 |
| InChIKey | IHJRTSIVDQBACF-ADUSHDQVSA-N |
| XLogP | 8.85 |
| TPSA | 61.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.43 |
| LogP ≤ 5 | 8.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |