C21H20N4O4 — CID 7343014
propan-2-yl (4R)-2-methyl-4-(4-nitrophenyl)-1,4-dihydropyrimido[1,2-a]benzimidazole-3-carboxylate (PubChem CID 7343014) has the molecular formula C21H20N4O4 and a molecular weight of 392.42 g/mol. Its IUPAC name is propan-2-yl (4R)-2-methyl-4-(4-nitrophenyl)-1,4-dihydropyrimido[1,2-a]benzimidazole-3-carboxylate.
| Compound Name | propan-2-yl (4R)-2-methyl-4-(4-nitrophenyl)-1,4-dihydropyrimido[1,2-a]benzimidazole-3-carboxylate |
|---|---|
| PubChem CID | 7343014 |
| Molecular Formula | C21H20N4O4 |
| Molecular Weight | 392.42 g/mol |
| Exact Mass | 392.15 |
| IUPAC Name | propan-2-yl (4R)-2-methyl-4-(4-nitrophenyl)-1,4-dihydropyrimido[1,2-a]benzimidazole-3-carboxylate |
| SMILES | CC1=C(C(=O)OC(C)C)[C@@H](c2ccc([N+](=O)[O-])cc2)n2c(nc3ccccc32)N1 |
| InChI | InChI=1S/C21H20N4O4/c1-12(2)29-20(26)18-13(3)22-21-23-16-6-4-5-7-17(16)24(21)19(18)14-8-10-15(11-9-14)25(27)28/h4-12,19H,1-3H3,(H,22,23)/t19-/m1/s1 |
| InChIKey | JGAUQBDIDDUXMY-LJQANCHMSA-N |
| XLogP | 4.18 |
| TPSA | 99.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.42 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|