C41H78N4O5 — CID 73430562
[2-[3-(diaminomethylamino)propanoylamino]-3-heptadec-9-enoyloxypropyl] heptadec-9-enoate (PubChem CID 73430562) has the molecular formula C41H78N4O5 and a molecular weight of 707.10 g/mol. Its IUPAC name is [2-[3-(diaminomethylamino)propanoylamino]-3-heptadec-9-enoyloxypropyl] heptadec-9-enoate.
| Compound Name | [2-[3-(diaminomethylamino)propanoylamino]-3-heptadec-9-enoyloxypropyl] heptadec-9-enoate |
|---|---|
| PubChem CID | 73430562 |
| Molecular Formula | C41H78N4O5 |
| Molecular Weight | 707.10 g/mol |
| Exact Mass | 706.60 |
| IUPAC Name | [2-[3-(diaminomethylamino)propanoylamino]-3-heptadec-9-enoyloxypropyl] heptadec-9-enoate |
| SMILES | CCCCCCCC=CCCCCCCCC(=O)OCC(COC(=O)CCCCCCCC=CCCCCCCC)NC(=O)CCNC(N)N |
| InChI | InChI=1S/C41H78N4O5/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-39(47)49-35-37(45-38(46)33-34-44-41(42)43)36-50-40(48)32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h15-18,37,41,44H,3-14,19-36,42-43H2,1-2H3,(H,45,46) |
| InChIKey | SDYPYCNDGYWNAW-UHFFFAOYSA-N |
| XLogP | 9.03 |
| TPSA | 145.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.10 |
| LogP ≤ 5 | 9.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|