C12H21N3 — CID 73430801
2-(5-aminohexa-1,3-dienyl)-3,4,5,6-tetrahydro-2H-azepin-7-amine (PubChem CID 73430801) has the molecular formula C12H21N3 and a molecular weight of 207.32 g/mol. Its IUPAC name is 2-(5-aminohexa-1,3-dienyl)-3,4,5,6-tetrahydro-2H-azepin-7-amine.
| Compound Name | 2-(5-aminohexa-1,3-dienyl)-3,4,5,6-tetrahydro-2H-azepin-7-amine |
|---|---|
| PubChem CID | 73430801 |
| Molecular Formula | C12H21N3 |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.17 |
| IUPAC Name | 2-(5-aminohexa-1,3-dienyl)-3,4,5,6-tetrahydro-2H-azepin-7-amine |
| SMILES | CC(N)C=CC=CC1CCCCC(N)=N1 |
| InChI | InChI=1S/C12H21N3/c1-10(13)6-2-3-7-11-8-4-5-9-12(14)15-11/h2-3,6-7,10-11H,4-5,8-9,13H2,1H3,(H2,14,15) |
| InChIKey | DZZQIACEPPHFHE-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|