C29H39NO2 — CID 73432816
8-[3-(1-adamantyl)-4-methoxyphenyl]-N-ethyl-4-methylnona-3,5,7-trienamide (PubChem CID 73432816) has the molecular formula C29H39NO2 and a molecular weight of 433.64 g/mol. Its IUPAC name is 8-[3-(1-adamantyl)-4-methoxyphenyl]-N-ethyl-4-methylnona-3,5,7-trienamide.
| Compound Name | 8-[3-(1-adamantyl)-4-methoxyphenyl]-N-ethyl-4-methylnona-3,5,7-trienamide |
|---|---|
| PubChem CID | 73432816 |
| Molecular Formula | C29H39NO2 |
| Molecular Weight | 433.64 g/mol |
| Exact Mass | 433.30 |
| IUPAC Name | 8-[3-(1-adamantyl)-4-methoxyphenyl]-N-ethyl-4-methylnona-3,5,7-trienamide |
| SMILES | CCNC(=O)CC=C(C)C=CC=C(C)c1ccc(OC)c(C23CC4CC(CC(C4)C2)C3)c1 |
| InChI | InChI=1S/C29H39NO2/c1-5-30-28(31)12-9-20(2)7-6-8-21(3)25-10-11-27(32-4)26(16-25)29-17-22-13-23(18-29)15-24(14-22)19-29/h6-11,16,22-24H,5,12-15,17-19H2,1-4H3,(H,30,31) |
| InChIKey | ISPUIMSSFYFEMD-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.64 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|