C31H32F6N4O5 — CID 73437744
[(3S,6R)-6-[2-[3-[3,3-bis(4-fluorophenyl)propanoylamino]-5-fluoro-4-pyridinyl]ethyl]morpholin-3-yl]methyl N-(1,1,1-trifluoro-3-hydroxypropan-2-yl)carbamate (PubChem CID 73437744) has the molecular formula C31H32F6N4O5 and a molecular weight of 654.61 g/mol. Its IUPAC name is [(3S,6R)-6-[2-[3-[3,3-bis(4-fluorophenyl)propanoylamino]-5-fluoro-4-pyridinyl]ethyl]morpholin-3-yl]methyl N-(1,1,1-trifluoro-3-hydroxypropan-2-yl)carbamate.
| Compound Name | [(3S,6R)-6-[2-[3-[3,3-bis(4-fluorophenyl)propanoylamino]-5-fluoro-4-pyridinyl]ethyl]morpholin-3-yl]methyl N-(1,1,1-trifluoro-3-hydroxypropan-2-yl)carbamate |
|---|---|
| PubChem CID | 73437744 |
| Molecular Formula | C31H32F6N4O5 |
| Molecular Weight | 654.61 g/mol |
| Exact Mass | 654.23 |
| IUPAC Name | [(3S,6R)-6-[2-[3-[3,3-bis(4-fluorophenyl)propanoylamino]-5-fluoro-4-pyridinyl]ethyl]morpholin-3-yl]methyl N-(1,1,1-trifluoro-3-hydroxypropan-2-yl)carbamate |
| SMILES | O=C(CC(c1ccc(F)cc1)c1ccc(F)cc1)Nc1cncc(F)c1CC[C@@H]1CN[C@H](COC(=O)NC(CO)C(F)(F)F)CO1 |
| InChI | InChI=1S/C31H32F6N4O5/c32-20-5-1-18(2-6-20)25(19-3-7-21(33)8-4-19)11-29(43)40-27-14-38-13-26(34)24(27)10-9-23-12-39-22(16-45-23)17-46-30(44)41-28(15-42)31(35,36)37/h1-8,13-14,22-23,25,28,39,42H,9-12,15-17H2,(H,40,43)(H,41,44)/t22-,23+,28?/m0/s1 |
| InChIKey | HKVQOIIPNUFSON-SYDXZMBCSA-N |
| XLogP | 4.60 |
| TPSA | 121.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.61 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |