C21H22F4N6O2S — CID 73437810
5-amino-N-[5-[(2R,5S,6R)-5-amino-4,4-difluoro-5,6-dimethyloxan-2-yl]-1-methylpyrazol-4-yl]-2-(2,6-difluorophenyl)-1,3-thiazole-4-carboxamide (PubChem CID 73437810) has the molecular formula C21H22F4N6O2S and a molecular weight of 498.51 g/mol. Its IUPAC name is 5-amino-N-[5-[(2R,5S,6R)-5-amino-4,4-difluoro-5,6-dimethyloxan-2-yl]-1-methylpyrazol-4-yl]-2-(2,6-difluorophenyl)-1,3-thiazole-4-carboxamide.
| Compound Name | 5-amino-N-[5-[(2R,5S,6R)-5-amino-4,4-difluoro-5,6-dimethyloxan-2-yl]-1-methylpyrazol-4-yl]-2-(2,6-difluorophenyl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 73437810 |
| Molecular Formula | C21H22F4N6O2S |
| Molecular Weight | 498.51 g/mol |
| Exact Mass | 498.15 |
| IUPAC Name | 5-amino-N-[5-[(2R,5S,6R)-5-amino-4,4-difluoro-5,6-dimethyloxan-2-yl]-1-methylpyrazol-4-yl]-2-(2,6-difluorophenyl)-1,3-thiazole-4-carboxamide |
| SMILES | C[C@H]1O[C@@H](c2c(NC(=O)c3nc(-c4c(F)cccc4F)sc3N)cnn2C)CC(F)(F)[C@@]1(C)N |
| InChI | InChI=1S/C21H22F4N6O2S/c1-9-20(2,27)21(24,25)7-13(33-9)16-12(8-28-31(16)3)29-18(32)15-17(26)34-19(30-15)14-10(22)5-4-6-11(14)23/h4-6,8-9,13H,7,26-27H2,1-3H3,(H,29,32)/t9-,13-,20+/m1/s1 |
| InChIKey | DQYDGUKDAQWPGW-RAFNUXFDSA-N |
| XLogP | 3.86 |
| TPSA | 121.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.51 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |