C27H22F3N7O3 — CID 73437952
9-(6-methoxy-3-pyridinyl)-1-[4-piperazin-1-yl-3-(trifluoromethyl)phenyl]pyrimido[5,4-c][1,5]naphthyridine-2,4-dione (PubChem CID 73437952) has the molecular formula C27H22F3N7O3 and a molecular weight of 549.51 g/mol. Its IUPAC name is 9-(6-methoxy-3-pyridinyl)-1-[4-piperazin-1-yl-3-(trifluoromethyl)phenyl]pyrimido[5,4-c][1,5]naphthyridine-2,4-dione.
| Compound Name | 9-(6-methoxy-3-pyridinyl)-1-[4-piperazin-1-yl-3-(trifluoromethyl)phenyl]pyrimido[5,4-c][1,5]naphthyridine-2,4-dione |
|---|---|
| PubChem CID | 73437952 |
| Molecular Formula | C27H22F3N7O3 |
| Molecular Weight | 549.51 g/mol |
| Exact Mass | 549.17 |
| IUPAC Name | 9-(6-methoxy-3-pyridinyl)-1-[4-piperazin-1-yl-3-(trifluoromethyl)phenyl]pyrimido[5,4-c][1,5]naphthyridine-2,4-dione |
| SMILES | COc1ccc(-c2ccc3ncc4c(=O)[nH]c(=O)n(-c5ccc(N6CCNCC6)c(C(F)(F)F)c5)c4c3n2)cn1 |
| InChI | InChI=1S/C27H22F3N7O3/c1-40-22-7-2-15(13-33-22)19-4-5-20-23(34-19)24-17(14-32-20)25(38)35-26(39)37(24)16-3-6-21(18(12-16)27(28,29)30)36-10-8-31-9-11-36/h2-7,12-14,31H,8-11H2,1H3,(H,35,38,39) |
| InChIKey | BTCFJOOKLNYYGK-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 118.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.51 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|