C27H23F3N8O2 — CID 73437954
9-(6-amino-3-pyridinyl)-3-methyl-1-[4-piperazin-1-yl-3-(trifluoromethyl)phenyl]pyrimido[5,4-c][1,5]naphthyridine-2,4-dione (PubChem CID 73437954) has the molecular formula C27H23F3N8O2 and a molecular weight of 548.53 g/mol. Its IUPAC name is 9-(6-amino-3-pyridinyl)-3-methyl-1-[4-piperazin-1-yl-3-(trifluoromethyl)phenyl]pyrimido[5,4-c][1,5]naphthyridine-2,4-dione.
| Compound Name | 9-(6-amino-3-pyridinyl)-3-methyl-1-[4-piperazin-1-yl-3-(trifluoromethyl)phenyl]pyrimido[5,4-c][1,5]naphthyridine-2,4-dione |
|---|---|
| PubChem CID | 73437954 |
| Molecular Formula | C27H23F3N8O2 |
| Molecular Weight | 548.53 g/mol |
| Exact Mass | 548.19 |
| IUPAC Name | 9-(6-amino-3-pyridinyl)-3-methyl-1-[4-piperazin-1-yl-3-(trifluoromethyl)phenyl]pyrimido[5,4-c][1,5]naphthyridine-2,4-dione |
| SMILES | Cn1c(=O)c2cnc3ccc(-c4ccc(N)nc4)nc3c2n(-c2ccc(N3CCNCC3)c(C(F)(F)F)c2)c1=O |
| InChI | InChI=1S/C27H23F3N8O2/c1-36-25(39)17-14-33-20-5-4-19(15-2-7-22(31)34-13-15)35-23(20)24(17)38(26(36)40)16-3-6-21(18(12-16)27(28,29)30)37-10-8-32-9-11-37/h2-7,12-14,32H,8-11H2,1H3,(H2,31,34) |
| InChIKey | VSWWBHYLMBBKJH-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 123.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.53 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|