C27H23F3N8O3 — CID 73437955
9-(6-amino-3-pyridinyl)-3-(hydroxymethyl)-1-[4-piperazin-1-yl-3-(trifluoromethyl)phenyl]pyrimido[5,4-c][1,5]naphthyridine-2,4-dione (PubChem CID 73437955) has the molecular formula C27H23F3N8O3 and a molecular weight of 564.53 g/mol. Its IUPAC name is 9-(6-amino-3-pyridinyl)-3-(hydroxymethyl)-1-[4-piperazin-1-yl-3-(trifluoromethyl)phenyl]pyrimido[5,4-c][1,5]naphthyridine-2,4-dione.
| Compound Name | 9-(6-amino-3-pyridinyl)-3-(hydroxymethyl)-1-[4-piperazin-1-yl-3-(trifluoromethyl)phenyl]pyrimido[5,4-c][1,5]naphthyridine-2,4-dione |
|---|---|
| PubChem CID | 73437955 |
| Molecular Formula | C27H23F3N8O3 |
| Molecular Weight | 564.53 g/mol |
| Exact Mass | 564.18 |
| IUPAC Name | 9-(6-amino-3-pyridinyl)-3-(hydroxymethyl)-1-[4-piperazin-1-yl-3-(trifluoromethyl)phenyl]pyrimido[5,4-c][1,5]naphthyridine-2,4-dione |
| SMILES | Nc1ccc(-c2ccc3ncc4c(=O)n(CO)c(=O)n(-c5ccc(N6CCNCC6)c(C(F)(F)F)c5)c4c3n2)cn1 |
| InChI | InChI=1S/C27H23F3N8O3/c28-27(29,30)18-11-16(2-5-21(18)36-9-7-32-8-10-36)38-24-17(25(40)37(14-39)26(38)41)13-33-20-4-3-19(35-23(20)24)15-1-6-22(31)34-12-15/h1-6,11-13,32,39H,7-10,14H2,(H2,31,34) |
| InChIKey | RDRPQTFAJVAFIY-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 144.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.53 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|