C28H23F3N8O3 — CID 73438009
N-[5-[2,4-dioxo-1-[4-piperazin-1-yl-3-(trifluoromethyl)phenyl]pyrimido[5,4-h][1,5]naphthyridin-9-yl]-2-pyridinyl]acetamide (PubChem CID 73438009) has the molecular formula C28H23F3N8O3 and a molecular weight of 576.54 g/mol. Its IUPAC name is N-[5-[2,4-dioxo-1-[4-piperazin-1-yl-3-(trifluoromethyl)phenyl]pyrimido[5,4-h][1,5]naphthyridin-9-yl]-2-pyridinyl]acetamide.
| Compound Name | N-[5-[2,4-dioxo-1-[4-piperazin-1-yl-3-(trifluoromethyl)phenyl]pyrimido[5,4-h][1,5]naphthyridin-9-yl]-2-pyridinyl]acetamide |
|---|---|
| PubChem CID | 73438009 |
| Molecular Formula | C28H23F3N8O3 |
| Molecular Weight | 576.54 g/mol |
| Exact Mass | 576.18 |
| IUPAC Name | N-[5-[2,4-dioxo-1-[4-piperazin-1-yl-3-(trifluoromethyl)phenyl]pyrimido[5,4-h][1,5]naphthyridin-9-yl]-2-pyridinyl]acetamide |
| SMILES | CC(=O)Nc1ccc(-c2ccc3ncc4c(=O)[nH]c(=O)n(-c5ccc(N6CCNCC6)c(C(F)(F)F)c5)c4c3n2)cn1 |
| InChI | InChI=1S/C28H23F3N8O3/c1-15(40)35-23-7-2-16(13-34-23)20-4-5-21-24(36-20)25-18(14-33-21)26(41)37-27(42)39(25)17-3-6-22(19(12-17)28(29,30)31)38-10-8-32-9-11-38/h2-7,12-14,32H,8-11H2,1H3,(H,34,35,40)(H,37,41,42) |
| InChIKey | VCBRBJROVZNHIP-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 137.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.54 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|