C29H22F3N9O2 — CID 73438054
1-[4-piperazin-1-yl-3-(trifluoromethyl)phenyl]-9-(6-pyrazol-1-yl-3-pyridinyl)pyrimido[5,4-c][1,5]naphthyridine-2,4-dione (PubChem CID 73438054) has the molecular formula C29H22F3N9O2 and a molecular weight of 585.55 g/mol. Its IUPAC name is 1-[4-piperazin-1-yl-3-(trifluoromethyl)phenyl]-9-(6-pyrazol-1-yl-3-pyridinyl)pyrimido[5,4-c][1,5]naphthyridine-2,4-dione.
| Compound Name | 1-[4-piperazin-1-yl-3-(trifluoromethyl)phenyl]-9-(6-pyrazol-1-yl-3-pyridinyl)pyrimido[5,4-c][1,5]naphthyridine-2,4-dione |
|---|---|
| PubChem CID | 73438054 |
| Molecular Formula | C29H22F3N9O2 |
| Molecular Weight | 585.55 g/mol |
| Exact Mass | 585.18 |
| IUPAC Name | 1-[4-piperazin-1-yl-3-(trifluoromethyl)phenyl]-9-(6-pyrazol-1-yl-3-pyridinyl)pyrimido[5,4-c][1,5]naphthyridine-2,4-dione |
| SMILES | O=c1[nH]c(=O)n(-c2ccc(N3CCNCC3)c(C(F)(F)F)c2)c2c1cnc1ccc(-c3ccc(-n4cccn4)nc3)nc12 |
| InChI | InChI=1S/C29H22F3N9O2/c30-29(31,32)20-14-18(3-6-23(20)39-12-9-33-10-13-39)41-26-19(27(42)38-28(41)43)16-34-22-5-4-21(37-25(22)26)17-2-7-24(35-15-17)40-11-1-8-36-40/h1-8,11,14-16,33H,9-10,12-13H2,(H,38,42,43) |
| InChIKey | BQDLMZHVSJLUAA-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 126.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.55 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|