C30H27F3N8O3 — CID 73438055
9-(6-morpholin-4-yl-3-pyridinyl)-1-[4-piperazin-1-yl-3-(trifluoromethyl)phenyl]pyrimido[5,4-c][1,5]naphthyridine-2,4-dione (PubChem CID 73438055) has the molecular formula C30H27F3N8O3 and a molecular weight of 604.59 g/mol. Its IUPAC name is 9-(6-morpholin-4-yl-3-pyridinyl)-1-[4-piperazin-1-yl-3-(trifluoromethyl)phenyl]pyrimido[5,4-c][1,5]naphthyridine-2,4-dione.
| Compound Name | 9-(6-morpholin-4-yl-3-pyridinyl)-1-[4-piperazin-1-yl-3-(trifluoromethyl)phenyl]pyrimido[5,4-c][1,5]naphthyridine-2,4-dione |
|---|---|
| PubChem CID | 73438055 |
| Molecular Formula | C30H27F3N8O3 |
| Molecular Weight | 604.59 g/mol |
| Exact Mass | 604.22 |
| IUPAC Name | 9-(6-morpholin-4-yl-3-pyridinyl)-1-[4-piperazin-1-yl-3-(trifluoromethyl)phenyl]pyrimido[5,4-c][1,5]naphthyridine-2,4-dione |
| SMILES | O=c1[nH]c(=O)n(-c2ccc(N3CCNCC3)c(C(F)(F)F)c2)c2c1cnc1ccc(-c3ccc(N4CCOCC4)nc3)nc12 |
| InChI | InChI=1S/C30H27F3N8O3/c31-30(32,33)21-15-19(2-5-24(21)39-9-7-34-8-10-39)41-27-20(28(42)38-29(41)43)17-35-23-4-3-22(37-26(23)27)18-1-6-25(36-16-18)40-11-13-44-14-12-40/h1-6,15-17,34H,7-14H2,(H,38,42,43) |
| InChIKey | ODFCLHNRPIJBDL-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 121.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.59 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|