C31H30F3N9O2 — CID 73438056
9-[6-(4-methylpiperazin-1-yl)-3-pyridinyl]-1-[4-piperazin-1-yl-3-(trifluoromethyl)phenyl]pyrimido[5,4-c][1,5]naphthyridine-2,4-dione (PubChem CID 73438056) has the molecular formula C31H30F3N9O2 and a molecular weight of 617.64 g/mol. Its IUPAC name is 9-[6-(4-methylpiperazin-1-yl)-3-pyridinyl]-1-[4-piperazin-1-yl-3-(trifluoromethyl)phenyl]pyrimido[5,4-c][1,5]naphthyridine-2,4-dione.
| Compound Name | 9-[6-(4-methylpiperazin-1-yl)-3-pyridinyl]-1-[4-piperazin-1-yl-3-(trifluoromethyl)phenyl]pyrimido[5,4-c][1,5]naphthyridine-2,4-dione |
|---|---|
| PubChem CID | 73438056 |
| Molecular Formula | C31H30F3N9O2 |
| Molecular Weight | 617.64 g/mol |
| Exact Mass | 617.25 |
| IUPAC Name | 9-[6-(4-methylpiperazin-1-yl)-3-pyridinyl]-1-[4-piperazin-1-yl-3-(trifluoromethyl)phenyl]pyrimido[5,4-c][1,5]naphthyridine-2,4-dione |
| SMILES | CN1CCN(c2ccc(-c3ccc4ncc5c(=O)[nH]c(=O)n(-c6ccc(N7CCNCC7)c(C(F)(F)F)c6)c5c4n3)cn2)CC1 |
| InChI | InChI=1S/C31H30F3N9O2/c1-40-12-14-42(15-13-40)26-7-2-19(17-37-26)23-4-5-24-27(38-23)28-21(18-36-24)29(44)39-30(45)43(28)20-3-6-25(22(16-20)31(32,33)34)41-10-8-35-9-11-41/h2-7,16-18,35H,8-15H2,1H3,(H,39,44,45) |
| InChIKey | PSZZSRBNNWWOBQ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 115.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.64 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|