C23H19F4N5O5 — CID 73438152
2-[5-[3-fluoro-4-(trifluoromethoxy)phenyl]-1,3-dihydroisoindol-2-yl]-N-[(6S)-2-nitro-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazin-6-yl]acetamide (PubChem CID 73438152) has the molecular formula C23H19F4N5O5 and a molecular weight of 521.43 g/mol. Its IUPAC name is 2-[5-[3-fluoro-4-(trifluoromethoxy)phenyl]-1,3-dihydroisoindol-2-yl]-N-[(6S)-2-nitro-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazin-6-yl]acetamide.
| Compound Name | 2-[5-[3-fluoro-4-(trifluoromethoxy)phenyl]-1,3-dihydroisoindol-2-yl]-N-[(6S)-2-nitro-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazin-6-yl]acetamide |
|---|---|
| PubChem CID | 73438152 |
| Molecular Formula | C23H19F4N5O5 |
| Molecular Weight | 521.43 g/mol |
| Exact Mass | 521.13 |
| IUPAC Name | 2-[5-[3-fluoro-4-(trifluoromethoxy)phenyl]-1,3-dihydroisoindol-2-yl]-N-[(6S)-2-nitro-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazin-6-yl]acetamide |
| SMILES | O=C(CN1Cc2ccc(-c3ccc(OC(F)(F)F)c(F)c3)cc2C1)N[C@@H]1COc2nc([N+](=O)[O-])cn2C1 |
| InChI | InChI=1S/C23H19F4N5O5/c24-18-6-14(3-4-19(18)37-23(25,26)27)13-1-2-15-7-30(8-16(15)5-13)11-21(33)28-17-9-31-10-20(32(34)35)29-22(31)36-12-17/h1-6,10,17H,7-9,11-12H2,(H,28,33)/t17-/m0/s1 |
| InChIKey | PUUQNFYMGDFPJF-KRWDZBQOSA-N |
| XLogP | 3.39 |
| TPSA | 111.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.43 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|