C18H28BrClN8O — CID 73438193
3,5-diamino-6-chloro-N-[N'-[(3S)-1-(3-methylbut-2-enyl)-1-azoniabicyclo[2.2.2]octan-3-yl]carbamimidoyl]pyrazine-2-carboxamide bromide (PubChem CID 73438193) has the molecular formula C18H28BrClN8O and a molecular weight of 487.83 g/mol. Its IUPAC name is 3,5-diamino-6-chloro-N-[N'-[(3S)-1-(3-methylbut-2-enyl)-1-azoniabicyclo[2.2.2]octan-3-yl]carbamimidoyl]pyrazine-2-carboxamide bromide.
| Compound Name | 3,5-diamino-6-chloro-N-[N'-[(3S)-1-(3-methylbut-2-enyl)-1-azoniabicyclo[2.2.2]octan-3-yl]carbamimidoyl]pyrazine-2-carboxamide bromide |
|---|---|
| PubChem CID | 73438193 |
| Molecular Formula | C18H28BrClN8O |
| Molecular Weight | 487.83 g/mol |
| Exact Mass | 486.13 |
| IUPAC Name | 3,5-diamino-6-chloro-N-[N'-[(3S)-1-(3-methylbut-2-enyl)-1-azoniabicyclo[2.2.2]octan-3-yl]carbamimidoyl]pyrazine-2-carboxamide bromide |
| SMILES | CC(C)=CC[N+]12CCC(CC1)[C@H](/N=C(\N)NC(=O)c1nc(Cl)c(N)nc1N)C2.[Br-] |
| InChI | InChI=1S/C18H27ClN8O.BrH/c1-10(2)3-6-27-7-4-11(5-8-27)12(9-27)23-18(22)26-17(28)13-15(20)25-16(21)14(19)24-13;/h3,11-12H,4-9H2,1-2H3,(H6-,20,21,22,23,25,26,28);1H/t11?,12-,27?;/m1./s1 |
| InChIKey | VXYMPCOZCKQFCA-RYAYPCCNSA-N |
| XLogP | -2.08 |
| TPSA | 145.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.83 |
| LogP ≤ 5 | -2.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|