C24H15F3N6O3 — CID 73438213
N-[5-[2,4-dioxo-1-[3-(trifluoromethyl)phenyl]pyrimido[5,4-h][1,5]naphthyridin-9-yl]-2-pyridinyl]acetamide (PubChem CID 73438213) has the molecular formula C24H15F3N6O3 and a molecular weight of 492.42 g/mol. Its IUPAC name is N-[5-[2,4-dioxo-1-[3-(trifluoromethyl)phenyl]pyrimido[5,4-h][1,5]naphthyridin-9-yl]-2-pyridinyl]acetamide.
| Compound Name | N-[5-[2,4-dioxo-1-[3-(trifluoromethyl)phenyl]pyrimido[5,4-h][1,5]naphthyridin-9-yl]-2-pyridinyl]acetamide |
|---|---|
| PubChem CID | 73438213 |
| Molecular Formula | C24H15F3N6O3 |
| Molecular Weight | 492.42 g/mol |
| Exact Mass | 492.12 |
| IUPAC Name | N-[5-[2,4-dioxo-1-[3-(trifluoromethyl)phenyl]pyrimido[5,4-h][1,5]naphthyridin-9-yl]-2-pyridinyl]acetamide |
| SMILES | CC(=O)Nc1ccc(-c2ccc3ncc4c(=O)[nH]c(=O)n(-c5cccc(C(F)(F)F)c5)c4c3n2)cn1 |
| InChI | InChI=1S/C24H15F3N6O3/c1-12(34)30-19-8-5-13(10-29-19)17-6-7-18-20(31-17)21-16(11-28-18)22(35)32-23(36)33(21)15-4-2-3-14(9-15)24(25,26)27/h2-11H,1H3,(H,29,30,34)(H,32,35,36) |
| InChIKey | CJCDILMZNLYXAM-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 122.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.42 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|