C24H33Cl2N9O2 — CID 73438248
3,5-diamino-6-chloro-N-[N'-[(3S)-1-[2-[methyl(2-phenylethyl)amino]-2-oxoethyl]-1-azoniabicyclo[2.2.2]octan-3-yl]carbamimidoyl]pyrazine-2-carboxamide chloride (PubChem CID 73438248) has the molecular formula C24H33Cl2N9O2 and a molecular weight of 550.50 g/mol. Its IUPAC name is 3,5-diamino-6-chloro-N-[N'-[(3S)-1-[2-[methyl(2-phenylethyl)amino]-2-oxoethyl]-1-azoniabicyclo[2.2.2]octan-3-yl]carbamimidoyl]pyrazine-2-carboxamide chloride.
| Compound Name | 3,5-diamino-6-chloro-N-[N'-[(3S)-1-[2-[methyl(2-phenylethyl)amino]-2-oxoethyl]-1-azoniabicyclo[2.2.2]octan-3-yl]carbamimidoyl]pyrazine-2-carboxamide chloride |
|---|---|
| PubChem CID | 73438248 |
| Molecular Formula | C24H33Cl2N9O2 |
| Molecular Weight | 550.50 g/mol |
| Exact Mass | 549.21 |
| IUPAC Name | 3,5-diamino-6-chloro-N-[N'-[(3S)-1-[2-[methyl(2-phenylethyl)amino]-2-oxoethyl]-1-azoniabicyclo[2.2.2]octan-3-yl]carbamimidoyl]pyrazine-2-carboxamide chloride |
| SMILES | CN(CCc1ccccc1)C(=O)C[N+]12CCC(CC1)[C@H](/N=C(\N)NC(=O)c1nc(Cl)c(N)nc1N)C2.[Cl-] |
| InChI | InChI=1S/C24H32ClN9O2.ClH/c1-33(10-7-15-5-3-2-4-6-15)18(35)14-34-11-8-16(9-12-34)17(13-34)29-24(28)32-23(36)19-21(26)31-22(27)20(25)30-19;/h2-6,16-17H,7-14H2,1H3,(H6-,26,27,28,29,31,32,36);1H/t16?,17-,34?;/m1./s1 |
| InChIKey | RUULAMHCCJCXDD-BAWYZTNTSA-N |
| XLogP | -2.35 |
| TPSA | 165.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.50 |
| LogP ≤ 5 | -2.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|