C27H22F3N7O2 — CID 73438267
9-[6-(4-methylpiperazin-1-yl)-3-pyridinyl]-1-[3-(trifluoromethyl)phenyl]pyrimido[5,4-c][1,5]naphthyridine-2,4-dione (PubChem CID 73438267) has the molecular formula C27H22F3N7O2 and a molecular weight of 533.51 g/mol. Its IUPAC name is 9-[6-(4-methylpiperazin-1-yl)-3-pyridinyl]-1-[3-(trifluoromethyl)phenyl]pyrimido[5,4-c][1,5]naphthyridine-2,4-dione.
| Compound Name | 9-[6-(4-methylpiperazin-1-yl)-3-pyridinyl]-1-[3-(trifluoromethyl)phenyl]pyrimido[5,4-c][1,5]naphthyridine-2,4-dione |
|---|---|
| PubChem CID | 73438267 |
| Molecular Formula | C27H22F3N7O2 |
| Molecular Weight | 533.51 g/mol |
| Exact Mass | 533.18 |
| IUPAC Name | 9-[6-(4-methylpiperazin-1-yl)-3-pyridinyl]-1-[3-(trifluoromethyl)phenyl]pyrimido[5,4-c][1,5]naphthyridine-2,4-dione |
| SMILES | CN1CCN(c2ccc(-c3ccc4ncc5c(=O)[nH]c(=O)n(-c6cccc(C(F)(F)F)c6)c5c4n3)cn2)CC1 |
| InChI | InChI=1S/C27H22F3N7O2/c1-35-9-11-36(12-10-35)22-8-5-16(14-32-22)20-6-7-21-23(33-20)24-19(15-31-21)25(38)34-26(39)37(24)18-4-2-3-17(13-18)27(28,29)30/h2-8,13-15H,9-12H2,1H3,(H,34,38,39) |
| InChIKey | BFJMJIPAKWRCIS-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 100.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.51 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|