C21H12F3N7O2 — CID 73438321
9-(2-aminopyrimidin-5-yl)-1-[3-(trifluoromethyl)phenyl]pyrimido[5,4-c][1,5]naphthyridine-2,4-dione (PubChem CID 73438321) has the molecular formula C21H12F3N7O2 and a molecular weight of 451.37 g/mol. Its IUPAC name is 9-(2-aminopyrimidin-5-yl)-1-[3-(trifluoromethyl)phenyl]pyrimido[5,4-c][1,5]naphthyridine-2,4-dione.
| Compound Name | 9-(2-aminopyrimidin-5-yl)-1-[3-(trifluoromethyl)phenyl]pyrimido[5,4-c][1,5]naphthyridine-2,4-dione |
|---|---|
| PubChem CID | 73438321 |
| Molecular Formula | C21H12F3N7O2 |
| Molecular Weight | 451.37 g/mol |
| Exact Mass | 451.10 |
| IUPAC Name | 9-(2-aminopyrimidin-5-yl)-1-[3-(trifluoromethyl)phenyl]pyrimido[5,4-c][1,5]naphthyridine-2,4-dione |
| SMILES | Nc1ncc(-c2ccc3ncc4c(=O)[nH]c(=O)n(-c5cccc(C(F)(F)F)c5)c4c3n2)cn1 |
| InChI | InChI=1S/C21H12F3N7O2/c22-21(23,24)11-2-1-3-12(6-11)31-17-13(18(32)30-20(31)33)9-26-15-5-4-14(29-16(15)17)10-7-27-19(25)28-8-10/h1-9H,(H2,25,27,28)(H,30,32,33) |
| InChIKey | JQQOPLRIUXGXLO-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 132.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.37 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|