C22H14F3N7O2 — CID 73438322
9-(2-aminopyrimidin-5-yl)-3-methyl-1-[3-(trifluoromethyl)phenyl]pyrimido[5,4-c][1,5]naphthyridine-2,4-dione (PubChem CID 73438322) has the molecular formula C22H14F3N7O2 and a molecular weight of 465.40 g/mol. Its IUPAC name is 9-(2-aminopyrimidin-5-yl)-3-methyl-1-[3-(trifluoromethyl)phenyl]pyrimido[5,4-c][1,5]naphthyridine-2,4-dione.
| Compound Name | 9-(2-aminopyrimidin-5-yl)-3-methyl-1-[3-(trifluoromethyl)phenyl]pyrimido[5,4-c][1,5]naphthyridine-2,4-dione |
|---|---|
| PubChem CID | 73438322 |
| Molecular Formula | C22H14F3N7O2 |
| Molecular Weight | 465.40 g/mol |
| Exact Mass | 465.12 |
| IUPAC Name | 9-(2-aminopyrimidin-5-yl)-3-methyl-1-[3-(trifluoromethyl)phenyl]pyrimido[5,4-c][1,5]naphthyridine-2,4-dione |
| SMILES | Cn1c(=O)c2cnc3ccc(-c4cnc(N)nc4)nc3c2n(-c2cccc(C(F)(F)F)c2)c1=O |
| InChI | InChI=1S/C22H14F3N7O2/c1-31-19(33)14-10-27-16-6-5-15(11-8-28-20(26)29-9-11)30-17(16)18(14)32(21(31)34)13-4-2-3-12(7-13)22(23,24)25/h2-10H,1H3,(H2,26,28,29) |
| InChIKey | DTVBJFBOJPQDFF-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 121.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.40 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|