C22H10F3N7O2 — CID 73438374
5-[2,4-dioxo-1-[3-(trifluoromethyl)phenyl]pyrimido[5,4-h][1,5]naphthyridin-9-yl]pyrimidine-2-carbonitrile (PubChem CID 73438374) has the molecular formula C22H10F3N7O2 and a molecular weight of 461.36 g/mol. Its IUPAC name is 5-[2,4-dioxo-1-[3-(trifluoromethyl)phenyl]pyrimido[5,4-h][1,5]naphthyridin-9-yl]pyrimidine-2-carbonitrile.
| Compound Name | 5-[2,4-dioxo-1-[3-(trifluoromethyl)phenyl]pyrimido[5,4-h][1,5]naphthyridin-9-yl]pyrimidine-2-carbonitrile |
|---|---|
| PubChem CID | 73438374 |
| Molecular Formula | C22H10F3N7O2 |
| Molecular Weight | 461.36 g/mol |
| Exact Mass | 461.08 |
| IUPAC Name | 5-[2,4-dioxo-1-[3-(trifluoromethyl)phenyl]pyrimido[5,4-h][1,5]naphthyridin-9-yl]pyrimidine-2-carbonitrile |
| SMILES | N#Cc1ncc(-c2ccc3ncc4c(=O)[nH]c(=O)n(-c5cccc(C(F)(F)F)c5)c4c3n2)cn1 |
| InChI | InChI=1S/C22H10F3N7O2/c23-22(24,25)12-2-1-3-13(6-12)32-19-14(20(33)31-21(32)34)10-27-16-5-4-15(30-18(16)19)11-8-28-17(7-26)29-9-11/h1-6,8-10H,(H,31,33,34) |
| InChIKey | DPBFPNMTWRUPOY-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 130.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.36 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|