C30H29F7N4O4 — CID 73438399
[(3S,6R)-6-[2-[3-[[(3S)-3-(2,5-difluorophenyl)-3-(4-fluorophenyl)propanoyl]amino]-5-fluoro-4-pyridinyl]ethyl]morpholin-3-yl]methyl N-(2,2,2-trifluoroethyl)carbamate (PubChem CID 73438399) has the molecular formula C30H29F7N4O4 and a molecular weight of 642.57 g/mol. Its IUPAC name is [(3S,6R)-6-[2-[3-[[(3S)-3-(2,5-difluorophenyl)-3-(4-fluorophenyl)propanoyl]amino]-5-fluoro-4-pyridinyl]ethyl]morpholin-3-yl]methyl N-(2,2,2-trifluoroethyl)carbamate.
| Compound Name | [(3S,6R)-6-[2-[3-[[(3S)-3-(2,5-difluorophenyl)-3-(4-fluorophenyl)propanoyl]amino]-5-fluoro-4-pyridinyl]ethyl]morpholin-3-yl]methyl N-(2,2,2-trifluoroethyl)carbamate |
|---|---|
| PubChem CID | 73438399 |
| Molecular Formula | C30H29F7N4O4 |
| Molecular Weight | 642.57 g/mol |
| Exact Mass | 642.21 |
| IUPAC Name | [(3S,6R)-6-[2-[3-[[(3S)-3-(2,5-difluorophenyl)-3-(4-fluorophenyl)propanoyl]amino]-5-fluoro-4-pyridinyl]ethyl]morpholin-3-yl]methyl N-(2,2,2-trifluoroethyl)carbamate |
| SMILES | O=C(C[C@@H](c1ccc(F)cc1)c1cc(F)ccc1F)Nc1cncc(F)c1CC[C@@H]1CN[C@H](COC(=O)NCC(F)(F)F)CO1 |
| InChI | InChI=1S/C30H29F7N4O4/c31-18-3-1-17(2-4-18)23(24-9-19(32)5-8-25(24)33)10-28(42)41-27-13-38-12-26(34)22(27)7-6-21-11-39-20(14-44-21)15-45-29(43)40-16-30(35,36)37/h1-5,8-9,12-13,20-21,23,39H,6-7,10-11,14-16H2,(H,40,43)(H,41,42)/t20-,21+,23-/m0/s1 |
| InChIKey | XYZHFRSZUIGGOU-XJUOHMSHSA-N |
| XLogP | 5.38 |
| TPSA | 101.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.57 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |