C20H21N3O3 — CID 73438777
(1R)-2-azido-1-[(3S,4S)-5-methoxy-4-[(E)-2-phenylethenyl]-3,4-dihydro-1H-isochromen-3-yl]ethanol (PubChem CID 73438777) has the molecular formula C20H21N3O3 and a molecular weight of 351.41 g/mol. Its IUPAC name is (1R)-2-azido-1-[(3S,4S)-5-methoxy-4-[(E)-2-phenylethenyl]-3,4-dihydro-1H-isochromen-3-yl]ethanol.
| Compound Name | (1R)-2-azido-1-[(3S,4S)-5-methoxy-4-[(E)-2-phenylethenyl]-3,4-dihydro-1H-isochromen-3-yl]ethanol |
|---|---|
| PubChem CID | 73438777 |
| Molecular Formula | C20H21N3O3 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | (1R)-2-azido-1-[(3S,4S)-5-methoxy-4-[(E)-2-phenylethenyl]-3,4-dihydro-1H-isochromen-3-yl]ethanol |
| SMILES | COc1cccc2c1[C@H](/C=C/c1ccccc1)[C@@H]([C@H](O)CN=[N+]=[N-])OC2 |
| InChI | InChI=1S/C20H21N3O3/c1-25-18-9-5-8-15-13-26-20(17(24)12-22-23-21)16(19(15)18)11-10-14-6-3-2-4-7-14/h2-11,16-17,20,24H,12-13H2,1H3/b11-10+/t16-,17+,20-/m0/s1 |
| InChIKey | WQGWJXORQCSWKT-FIAJCMGISA-N |
| XLogP | 4.06 |
| TPSA | 87.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|