C11H15N3O — CID 73439506
N-methyl-2-pyridin-2-ylpyrrolidine-2-carboxamide (PubChem CID 73439506) has the molecular formula C11H15N3O and a molecular weight of 205.26 g/mol. Its IUPAC name is N-methyl-2-pyridin-2-ylpyrrolidine-2-carboxamide.
| Compound Name | N-methyl-2-pyridin-2-ylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 73439506 |
| Molecular Formula | C11H15N3O |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.12 |
| IUPAC Name | N-methyl-2-pyridin-2-ylpyrrolidine-2-carboxamide |
| SMILES | CNC(=O)C1(c2ccccn2)CCCN1 |
| InChI | InChI=1S/C11H15N3O/c1-12-10(15)11(6-4-8-14-11)9-5-2-3-7-13-9/h2-3,5,7,14H,4,6,8H2,1H3,(H,12,15) |
| InChIKey | JSXJDBRJCWKLPP-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |