About 2-methyl-4-[(4-methyl-1,3-thiazol-5-yl)methyl]morpholine-2-carboxamide
2-methyl-4-[(4-methyl-1,3-thiazol-5-yl)methyl]morpholine-2-carboxamide (PubChem CID 73439585) has the molecular formula C11H17N3O2S
and a molecular weight of 255.34 g/mol. Its IUPAC name is 2-methyl-4-[(4-methyl-1,3-thiazol-5-yl)methyl]morpholine-2-carboxamide.
Molecular Properties
| Compound Name | 2-methyl-4-[(4-methyl-1,3-thiazol-5-yl)methyl]morpholine-2-carboxamide |
| PubChem CID | 73439585 |
| Molecular Formula | C11H17N3O2S |
| Molecular Weight | 255.34 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | 2-methyl-4-[(4-methyl-1,3-thiazol-5-yl)methyl]morpholine-2-carboxamide |
| SMILES | Cc1ncsc1CN1CCOC(C)(C(N)=O)C1 |
| InChI | InChI=1S/C11H17N3O2S/c1-8-9(17-7-13-8)5-14-3-4-16-11(2,6-14)10(12)15/h7H,3-6H2,1-2H3,(H2,12,15) |
| InChIKey | BSXXYDDXZNLBCI-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 68.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.34 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-methyl-4-[(4-methyl-1,3-thiazol-5-yl)methyl]morpholine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-4-[(4-methyl-1,3-thiazol-5-yl)methyl]morpholine-2-carboxamide?
The IUPAC name of 2-methyl-4-[(4-methyl-1,3-thiazol-5-yl)methyl]morpholine-2-carboxamide (CID 73439585) is 2-methyl-4-[(4-methyl-1,3-thiazol-5-yl)methyl]morpholine-2-carboxamide.
What is the SMILES notation for 2-methyl-4-[(4-methyl-1,3-thiazol-5-yl)methyl]morpholine-2-carboxamide?
The canonical SMILES for 2-methyl-4-[(4-methyl-1,3-thiazol-5-yl)methyl]morpholine-2-carboxamide is Cc1ncsc1CN1CCOC(C)(C(N)=O)C1.
What is the InChIKey of 2-methyl-4-[(4-methyl-1,3-thiazol-5-yl)methyl]morpholine-2-carboxamide?
The InChIKey is BSXXYDDXZNLBCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17N3O2S/c1-8-9(17-7-13-8)5-14-3-4-16-11(2,6-14)10(12)15/h7H,3-6H2,1-2H3,(H2,12,15).
What are the key properties of 2-methyl-4-[(4-methyl-1,3-thiazol-5-yl)methyl]morpholine-2-carboxamide?
2-methyl-4-[(4-methyl-1,3-thiazol-5-yl)methyl]morpholine-2-carboxamide has a molecular weight of 255.34 g/mol, XLogP of 0.53, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-4-[(4-methyl-1,3-thiazol-5-yl)methyl]morpholine-2-carboxamide is sourced from PubChem (CID 73439585), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).