About 6-(quinolin-3-ylmethyl)-1,4-oxazepane
6-(quinolin-3-ylmethyl)-1,4-oxazepane (PubChem CID 73439711) has the molecular formula C15H18N2O
and a molecular weight of 242.32 g/mol. Its IUPAC name is 6-(quinolin-3-ylmethyl)-1,4-oxazepane.
Molecular Properties
| Compound Name | 6-(quinolin-3-ylmethyl)-1,4-oxazepane |
| PubChem CID | 73439711 |
| Molecular Formula | C15H18N2O |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.14 |
| IUPAC Name | 6-(quinolin-3-ylmethyl)-1,4-oxazepane |
| SMILES | c1ccc2ncc(CC3CNCCOC3)cc2c1 |
| InChI | InChI=1S/C15H18N2O/c1-2-4-15-14(3-1)8-12(10-17-15)7-13-9-16-5-6-18-11-13/h1-4,8,10,13,16H,5-7,9,11H2 |
| InChIKey | DMJSVEXVKXNDFA-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-(quinolin-3-ylmethyl)-1,4-oxazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(quinolin-3-ylmethyl)-1,4-oxazepane?
The IUPAC name of 6-(quinolin-3-ylmethyl)-1,4-oxazepane (CID 73439711) is 6-(quinolin-3-ylmethyl)-1,4-oxazepane.
What is the SMILES notation for 6-(quinolin-3-ylmethyl)-1,4-oxazepane?
The canonical SMILES for 6-(quinolin-3-ylmethyl)-1,4-oxazepane is c1ccc2ncc(CC3CNCCOC3)cc2c1.
What is the InChIKey of 6-(quinolin-3-ylmethyl)-1,4-oxazepane?
The InChIKey is DMJSVEXVKXNDFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18N2O/c1-2-4-15-14(3-1)8-12(10-17-15)7-13-9-16-5-6-18-11-13/h1-4,8,10,13,16H,5-7,9,11H2.
What are the key properties of 6-(quinolin-3-ylmethyl)-1,4-oxazepane?
6-(quinolin-3-ylmethyl)-1,4-oxazepane has a molecular weight of 242.32 g/mol, XLogP of 2.01, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(quinolin-3-ylmethyl)-1,4-oxazepane is sourced from PubChem (CID 73439711), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).