C14H22N2OS — CID 73440171
2-[[1-(oxan-4-yl)piperidin-3-yl]methyl]-1,3-thiazole (PubChem CID 73440171) has the molecular formula C14H22N2OS and a molecular weight of 266.41 g/mol. Its IUPAC name is 2-[[1-(oxan-4-yl)piperidin-3-yl]methyl]-1,3-thiazole.
| Compound Name | 2-[[1-(oxan-4-yl)piperidin-3-yl]methyl]-1,3-thiazole |
|---|---|
| PubChem CID | 73440171 |
| Molecular Formula | C14H22N2OS |
| Molecular Weight | 266.41 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | 2-[[1-(oxan-4-yl)piperidin-3-yl]methyl]-1,3-thiazole |
| SMILES | c1csc(CC2CCCN(C3CCOCC3)C2)n1 |
| InChI | InChI=1S/C14H22N2OS/c1-2-12(10-14-15-5-9-18-14)11-16(6-1)13-3-7-17-8-4-13/h5,9,12-13H,1-4,6-8,10-11H2 |
| InChIKey | YNTIBRDVLNHXAH-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.41 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |