C13H20N4O — CID 73440492
1-[(2R,6R)-12-methyl-1,4,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-9,11-dien-4-yl]butan-1-one (PubChem CID 73440492) has the molecular formula C13H20N4O and a molecular weight of 248.33 g/mol. Its IUPAC name is 1-[(2R,6R)-12-methyl-1,4,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-9,11-dien-4-yl]butan-1-one.
| Compound Name | 1-[(2R,6R)-12-methyl-1,4,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-9,11-dien-4-yl]butan-1-one |
|---|---|
| PubChem CID | 73440492 |
| Molecular Formula | C13H20N4O |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.16 |
| IUPAC Name | 1-[(2R,6R)-12-methyl-1,4,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-9,11-dien-4-yl]butan-1-one |
| SMILES | CCCC(=O)N1C[C@H]2CCc3nnc(C)n3[C@H]2C1 |
| InChI | InChI=1S/C13H20N4O/c1-3-4-13(18)16-7-10-5-6-12-15-14-9(2)17(12)11(10)8-16/h10-11H,3-8H2,1-2H3/t10-,11+/m1/s1 |
| InChIKey | PBAZAJCKEPBEQH-MNOVXSKESA-N |
| XLogP | 1.33 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |