C13H14ClNO3 — CID 73440590
7-chlorospiro[3,4-dihydro-1,4-benzoxazepine-2,4'-oxane]-5-one (PubChem CID 73440590) has the molecular formula C13H14ClNO3 and a molecular weight of 267.71 g/mol. Its IUPAC name is 7-chlorospiro[3,4-dihydro-1,4-benzoxazepine-2,4'-oxane]-5-one.
| Compound Name | 7-chlorospiro[3,4-dihydro-1,4-benzoxazepine-2,4'-oxane]-5-one |
|---|---|
| PubChem CID | 73440590 |
| Molecular Formula | C13H14ClNO3 |
| Molecular Weight | 267.71 g/mol |
| Exact Mass | 267.07 |
| IUPAC Name | 7-chlorospiro[3,4-dihydro-1,4-benzoxazepine-2,4'-oxane]-5-one |
| SMILES | O=C1NCC2(CCOCC2)Oc2ccc(Cl)cc21 |
| InChI | InChI=1S/C13H14ClNO3/c14-9-1-2-11-10(7-9)12(16)15-8-13(18-11)3-5-17-6-4-13/h1-2,7H,3-6,8H2,(H,15,16) |
| InChIKey | WJMORFRJPNYTKY-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.71 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |