1,2-dimethylpiperidine-2-carboxylic acid

C8H15NO2 — CID 73440704

IUPAC1,2-dimethylpiperidine-2-carboxylic acid
SMILESCN1CCCCC1(C)C(=O)O
InChIInChI=1S/C8H15NO2/c1-8(7(10)11)5-3-4-6-9(8)2/h3-6H2,1-2H3,(H,10,11)
InChIKeyHAMVADKINVXMMK-UHFFFAOYSA-N
MW157.21 g/mol
LogP0.95
Rot. Bonds1

About 1,2-dimethylpiperidine-2-carboxylic acid

1,2-dimethylpiperidine-2-carboxylic acid (PubChem CID 73440704) has the molecular formula C8H15NO2 and a molecular weight of 157.21 g/mol. Its IUPAC name is 1,2-dimethylpiperidine-2-carboxylic acid.

Molecular Properties

Compound Name1,2-dimethylpiperidine-2-carboxylic acid
PubChem CID73440704
Molecular FormulaC8H15NO2
Molecular Weight157.21 g/mol
Exact Mass157.11
IUPAC Name1,2-dimethylpiperidine-2-carboxylic acid
SMILESCN1CCCCC1(C)C(=O)O
InChIInChI=1S/C8H15NO2/c1-8(7(10)11)5-3-4-6-9(8)2/h3-6H2,1-2H3,(H,10,11)
InChIKeyHAMVADKINVXMMK-UHFFFAOYSA-N
XLogP0.95
TPSA40.54 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500157.21
LogP ≤ 50.95
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 1,2-dimethylpiperidine-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

(2R)-1,2-dimethylazetidine-2-carboxylic acid;hydrochloride
CID 70559346
1-methylpyrrolidine-2,2-dicarboxylic acid
CID 83669888
1-(2,2-difluoroacetyl)-2-methylpiperidine-2-carboxylic acid
CID 103513470
1-(azepan-1-ylsulfonyl)-2-methylpiperidine-2-carboxylic acid
CID 104595620
CID 162348779
CID 162348779
1-(2-aminopropanoyl)-2-methylpiperidine-2-carboxylic acid
CID 104597343
1-but-2-ynyl-2-methylpiperidine-2-carboxylic acid
CID 104598631
2-methyl-1-(1-methylazepan-4-yl)piperidine-2-carboxylic acid
CID 104599068
2-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-2-carboxylic acid
CID 42614787
(2R)-2-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-2-carboxylic acid
CID 27281688
2-methyl-1-(2-methylcyclopropanecarbonyl)piperidine-2-carboxylic acid
CID 104595064
1-(1,2-dimethylazetidin-2-yl)ethanone
CID 130343037

Frequently Asked Questions

What is the IUPAC name of 1,2-dimethylpiperidine-2-carboxylic acid?
The IUPAC name of 1,2-dimethylpiperidine-2-carboxylic acid (CID 73440704) is 1,2-dimethylpiperidine-2-carboxylic acid.
What is the SMILES notation for 1,2-dimethylpiperidine-2-carboxylic acid?
The canonical SMILES for 1,2-dimethylpiperidine-2-carboxylic acid is CN1CCCCC1(C)C(=O)O.
What is the InChIKey of 1,2-dimethylpiperidine-2-carboxylic acid?
The InChIKey is HAMVADKINVXMMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO2/c1-8(7(10)11)5-3-4-6-9(8)2/h3-6H2,1-2H3,(H,10,11).
What are the key properties of 1,2-dimethylpiperidine-2-carboxylic acid?
1,2-dimethylpiperidine-2-carboxylic acid has a molecular weight of 157.21 g/mol, XLogP of 0.95, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dimethylpiperidine-2-carboxylic acid is sourced from PubChem (CID 73440704), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).