C22H23NO4 — CID 73440849
(2R,6S)-2-[(4-methoxyphenoxy)methyl]-1',4-dimethylspiro[2,5-dihydropyran-6,3'-indole]-2'-one (PubChem CID 73440849) has the molecular formula C22H23NO4 and a molecular weight of 365.43 g/mol. Its IUPAC name is (2R,6S)-2-[(4-methoxyphenoxy)methyl]-1',4-dimethylspiro[2,5-dihydropyran-6,3'-indole]-2'-one.
| Compound Name | (2R,6S)-2-[(4-methoxyphenoxy)methyl]-1',4-dimethylspiro[2,5-dihydropyran-6,3'-indole]-2'-one |
|---|---|
| PubChem CID | 73440849 |
| Molecular Formula | C22H23NO4 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | (2R,6S)-2-[(4-methoxyphenoxy)methyl]-1',4-dimethylspiro[2,5-dihydropyran-6,3'-indole]-2'-one |
| SMILES | COc1ccc(OC[C@H]2C=C(C)C[C@@]3(O2)C(=O)N(C)c2ccccc23)cc1 |
| InChI | InChI=1S/C22H23NO4/c1-15-12-18(14-26-17-10-8-16(25-3)9-11-17)27-22(13-15)19-6-4-5-7-20(19)23(2)21(22)24/h4-12,18H,13-14H2,1-3H3/t18-,22+/m1/s1 |
| InChIKey | GIBNPPWHLIQSDG-GCJKJVERSA-N |
| XLogP | 3.68 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|