C22H28N2O4 — CID 73440921
(9E,11R,12S,15S)-11-methyl-12-phenyl-6-oxa-1,13-diazabicyclo[13.3.0]octadec-9-ene-2,7,14-trione (PubChem CID 73440921) has the molecular formula C22H28N2O4 and a molecular weight of 384.48 g/mol. Its IUPAC name is (9E,11R,12S,15S)-11-methyl-12-phenyl-6-oxa-1,13-diazabicyclo[13.3.0]octadec-9-ene-2,7,14-trione.
| Compound Name | (9E,11R,12S,15S)-11-methyl-12-phenyl-6-oxa-1,13-diazabicyclo[13.3.0]octadec-9-ene-2,7,14-trione |
|---|---|
| PubChem CID | 73440921 |
| Molecular Formula | C22H28N2O4 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | (9E,11R,12S,15S)-11-methyl-12-phenyl-6-oxa-1,13-diazabicyclo[13.3.0]octadec-9-ene-2,7,14-trione |
| SMILES | C[C@@H]1/C=C/CC(=O)OCCCC(=O)N2CCC[C@H]2C(=O)N[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C22H28N2O4/c1-16-8-5-13-20(26)28-15-7-12-19(25)24-14-6-11-18(24)22(27)23-21(16)17-9-3-2-4-10-17/h2-5,8-10,16,18,21H,6-7,11-15H2,1H3,(H,23,27)/b8-5+/t16-,18+,21+/m1/s1 |
| InChIKey | QGMHYRLPDZGEKI-SAADTILNSA-N |
| XLogP | 2.75 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|