C23H40N2O5 — CID 73440981
1-[3-[(3S,3aS,4S,5R,7aR)-5,7a-dihydroxy-3-[(1R)-1-hydroxy-4-methylpent-3-enyl]-4-methoxy-3-methyl-1,3a,4,5,6,7-hexahydroisoindol-2-yl]propyl]pyrrolidin-2-one (PubChem CID 73440981) has the molecular formula C23H40N2O5 and a molecular weight of 424.58 g/mol. Its IUPAC name is 1-[3-[(3S,3aS,4S,5R,7aR)-5,7a-dihydroxy-3-[(1R)-1-hydroxy-4-methylpent-3-enyl]-4-methoxy-3-methyl-1,3a,4,5,6,7-hexahydroisoindol-2-yl]propyl]pyrrolidin-2-one.
| Compound Name | 1-[3-[(3S,3aS,4S,5R,7aR)-5,7a-dihydroxy-3-[(1R)-1-hydroxy-4-methylpent-3-enyl]-4-methoxy-3-methyl-1,3a,4,5,6,7-hexahydroisoindol-2-yl]propyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 73440981 |
| Molecular Formula | C23H40N2O5 |
| Molecular Weight | 424.58 g/mol |
| Exact Mass | 424.29 |
| IUPAC Name | 1-[3-[(3S,3aS,4S,5R,7aR)-5,7a-dihydroxy-3-[(1R)-1-hydroxy-4-methylpent-3-enyl]-4-methoxy-3-methyl-1,3a,4,5,6,7-hexahydroisoindol-2-yl]propyl]pyrrolidin-2-one |
| SMILES | CO[C@@H]1[C@H](O)CC[C@]2(O)CN(CCCN3CCCC3=O)[C@](C)([C@H](O)CC=C(C)C)[C@@H]12 |
| InChI | InChI=1S/C23H40N2O5/c1-16(2)8-9-18(27)22(3)21-20(30-4)17(26)10-11-23(21,29)15-25(22)14-6-13-24-12-5-7-19(24)28/h8,17-18,20-21,26-27,29H,5-7,9-15H2,1-4H3/t17-,18-,20-,21-,22-,23+/m1/s1 |
| InChIKey | BPQLYSLLQFJERS-ZOGCLFRTSA-N |
| XLogP | 1.31 |
| TPSA | 93.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.58 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|