C22H41NO5 — CID 73440986
(1S,3aR,6R,7S,7aS)-1-[(1R)-1-hydroxy-4-methylpent-3-enyl]-7-methoxy-1-methyl-2-(3-propan-2-yloxypropyl)-3,4,5,6,7,7a-hexahydroisoindole-3a,6-diol (PubChem CID 73440986) has the molecular formula C22H41NO5 and a molecular weight of 399.57 g/mol. Its IUPAC name is (1S,3aR,6R,7S,7aS)-1-[(1R)-1-hydroxy-4-methylpent-3-enyl]-7-methoxy-1-methyl-2-(3-propan-2-yloxypropyl)-3,4,5,6,7,7a-hexahydroisoindole-3a,6-diol.
| Compound Name | (1S,3aR,6R,7S,7aS)-1-[(1R)-1-hydroxy-4-methylpent-3-enyl]-7-methoxy-1-methyl-2-(3-propan-2-yloxypropyl)-3,4,5,6,7,7a-hexahydroisoindole-3a,6-diol |
|---|---|
| PubChem CID | 73440986 |
| Molecular Formula | C22H41NO5 |
| Molecular Weight | 399.57 g/mol |
| Exact Mass | 399.30 |
| IUPAC Name | (1S,3aR,6R,7S,7aS)-1-[(1R)-1-hydroxy-4-methylpent-3-enyl]-7-methoxy-1-methyl-2-(3-propan-2-yloxypropyl)-3,4,5,6,7,7a-hexahydroisoindole-3a,6-diol |
| SMILES | CO[C@@H]1[C@H](O)CC[C@]2(O)CN(CCCOC(C)C)[C@](C)([C@H](O)CC=C(C)C)[C@@H]12 |
| InChI | InChI=1S/C22H41NO5/c1-15(2)8-9-18(25)21(5)20-19(27-6)17(24)10-11-22(20,26)14-23(21)12-7-13-28-16(3)4/h8,16-20,24-26H,7,9-14H2,1-6H3/t17-,18-,19-,20-,21-,22+/m1/s1 |
| InChIKey | WHFJRRZYVXEDOL-ILHTXMRTSA-N |
| XLogP | 2.11 |
| TPSA | 82.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.57 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|