C20H35NO4 — CID 73440988
(1S,3aR,6R,7S,7aS)-2-(cyclopropylmethyl)-1-[(1R)-1-hydroxy-4-methylpent-3-enyl]-7-methoxy-1-methyl-3,4,5,6,7,7a-hexahydroisoindole-3a,6-diol (PubChem CID 73440988) has the molecular formula C20H35NO4 and a molecular weight of 353.50 g/mol. Its IUPAC name is (1S,3aR,6R,7S,7aS)-2-(cyclopropylmethyl)-1-[(1R)-1-hydroxy-4-methylpent-3-enyl]-7-methoxy-1-methyl-3,4,5,6,7,7a-hexahydroisoindole-3a,6-diol.
| Compound Name | (1S,3aR,6R,7S,7aS)-2-(cyclopropylmethyl)-1-[(1R)-1-hydroxy-4-methylpent-3-enyl]-7-methoxy-1-methyl-3,4,5,6,7,7a-hexahydroisoindole-3a,6-diol |
|---|---|
| PubChem CID | 73440988 |
| Molecular Formula | C20H35NO4 |
| Molecular Weight | 353.50 g/mol |
| Exact Mass | 353.26 |
| IUPAC Name | (1S,3aR,6R,7S,7aS)-2-(cyclopropylmethyl)-1-[(1R)-1-hydroxy-4-methylpent-3-enyl]-7-methoxy-1-methyl-3,4,5,6,7,7a-hexahydroisoindole-3a,6-diol |
| SMILES | CO[C@@H]1[C@H](O)CC[C@]2(O)CN(CC3CC3)[C@](C)([C@H](O)CC=C(C)C)[C@@H]12 |
| InChI | InChI=1S/C20H35NO4/c1-13(2)5-8-16(23)19(3)18-17(25-4)15(22)9-10-20(18,24)12-21(19)11-14-6-7-14/h5,14-18,22-24H,6-12H2,1-4H3/t15-,16-,17-,18-,19-,20+/m1/s1 |
| InChIKey | GPGXARHHAGOPOV-PJBUMPDVSA-N |
| XLogP | 1.70 |
| TPSA | 73.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.50 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|