C21H37NO4 — CID 73441009
(1S,3aR,6R,7S,7aS)-2-cyclopentyl-1-[(1R)-1-hydroxy-4-methylpent-3-enyl]-7-methoxy-1-methyl-3,4,5,6,7,7a-hexahydroisoindole-3a,6-diol (PubChem CID 73441009) has the molecular formula C21H37NO4 and a molecular weight of 367.53 g/mol. Its IUPAC name is (1S,3aR,6R,7S,7aS)-2-cyclopentyl-1-[(1R)-1-hydroxy-4-methylpent-3-enyl]-7-methoxy-1-methyl-3,4,5,6,7,7a-hexahydroisoindole-3a,6-diol.
| Compound Name | (1S,3aR,6R,7S,7aS)-2-cyclopentyl-1-[(1R)-1-hydroxy-4-methylpent-3-enyl]-7-methoxy-1-methyl-3,4,5,6,7,7a-hexahydroisoindole-3a,6-diol |
|---|---|
| PubChem CID | 73441009 |
| Molecular Formula | C21H37NO4 |
| Molecular Weight | 367.53 g/mol |
| Exact Mass | 367.27 |
| IUPAC Name | (1S,3aR,6R,7S,7aS)-2-cyclopentyl-1-[(1R)-1-hydroxy-4-methylpent-3-enyl]-7-methoxy-1-methyl-3,4,5,6,7,7a-hexahydroisoindole-3a,6-diol |
| SMILES | CO[C@@H]1[C@H](O)CC[C@]2(O)CN(C3CCCC3)[C@](C)([C@H](O)CC=C(C)C)[C@@H]12 |
| InChI | InChI=1S/C21H37NO4/c1-14(2)9-10-17(24)20(3)19-18(26-4)16(23)11-12-21(19,25)13-22(20)15-7-5-6-8-15/h9,15-19,23-25H,5-8,10-13H2,1-4H3/t16-,17-,18-,19-,20-,21+/m1/s1 |
| InChIKey | BVJGRRPJFCEEQQ-UFOPBENGSA-N |
| XLogP | 2.24 |
| TPSA | 73.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.53 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|