About (2'R,5R)-2'-methoxy-4-phenyl-2'-thiophen-2-ylspiro[2H-furan-5,3'-chromene]-4'-one
(2'R,5R)-2'-methoxy-4-phenyl-2'-thiophen-2-ylspiro[2H-furan-5,3'-chromene]-4'-one (PubChem CID 73441321) has the molecular formula C23H18O4S
and a molecular weight of 390.46 g/mol. Its IUPAC name is (2'R,5R)-2'-methoxy-4-phenyl-2'-thiophen-2-ylspiro[2H-furan-5,3'-chromene]-4'-one.
Molecular Properties
| Compound Name | (2'R,5R)-2'-methoxy-4-phenyl-2'-thiophen-2-ylspiro[2H-furan-5,3'-chromene]-4'-one |
| PubChem CID | 73441321 |
| Molecular Formula | C23H18O4S |
| Molecular Weight | 390.46 g/mol |
| Exact Mass | 390.09 |
| IUPAC Name | (2'R,5R)-2'-methoxy-4-phenyl-2'-thiophen-2-ylspiro[2H-furan-5,3'-chromene]-4'-one |
| SMILES | CO[C@@]1(c2cccs2)Oc2ccccc2C(=O)[C@@]12OCC=C2c1ccccc1 |
| InChI | InChI=1S/C23H18O4S/c1-25-23(20-12-7-15-28-20)22(21(24)17-10-5-6-11-19(17)27-23)18(13-14-26-22)16-8-3-2-4-9-16/h2-13,15H,14H2,1H3/t22-,23+/m1/s1 |
| InChIKey | IEMAUMNLYNLBQP-PKTZIBPZSA-N |
| XLogP | 4.68 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 390.46 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2'R,5R)-2'-methoxy-4-phenyl-2'-thiophen-2-ylspiro[2H-furan-5,3'-chromene]-4'-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2'R,5R)-2'-methoxy-4-phenyl-2'-thiophen-2-ylspiro[2H-furan-5,3'-chromene]-4'-one?
The IUPAC name of (2'R,5R)-2'-methoxy-4-phenyl-2'-thiophen-2-ylspiro[2H-furan-5,3'-chromene]-4'-one (CID 73441321) is (2'R,5R)-2'-methoxy-4-phenyl-2'-thiophen-2-ylspiro[2H-furan-5,3'-chromene]-4'-one.
What is the SMILES notation for (2'R,5R)-2'-methoxy-4-phenyl-2'-thiophen-2-ylspiro[2H-furan-5,3'-chromene]-4'-one?
The canonical SMILES for (2'R,5R)-2'-methoxy-4-phenyl-2'-thiophen-2-ylspiro[2H-furan-5,3'-chromene]-4'-one is CO[C@@]1(c2cccs2)Oc2ccccc2C(=O)[C@@]12OCC=C2c1ccccc1.
What is the InChIKey of (2'R,5R)-2'-methoxy-4-phenyl-2'-thiophen-2-ylspiro[2H-furan-5,3'-chromene]-4'-one?
The InChIKey is IEMAUMNLYNLBQP-PKTZIBPZSA-N. The full InChI is InChI=1S/C23H18O4S/c1-25-23(20-12-7-15-28-20)22(21(24)17-10-5-6-11-19(17)27-23)18(13-14-26-22)16-8-3-2-4-9-16/h2-13,15H,14H2,1H3/t22-,23+/m1/s1.
What are the key properties of (2'R,5R)-2'-methoxy-4-phenyl-2'-thiophen-2-ylspiro[2H-furan-5,3'-chromene]-4'-one?
(2'R,5R)-2'-methoxy-4-phenyl-2'-thiophen-2-ylspiro[2H-furan-5,3'-chromene]-4'-one has a molecular weight of 390.46 g/mol, XLogP of 4.68, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2'R,5R)-2'-methoxy-4-phenyl-2'-thiophen-2-ylspiro[2H-furan-5,3'-chromene]-4'-one is sourced from PubChem (CID 73441321), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).