C28H32O4 — CID 73441611
8-benzoyl-5-methoxy-2,2-dimethyl-3,6,6-tris(prop-2-enyl)-3,4-dihydrochromen-7-one (PubChem CID 73441611) has the molecular formula C28H32O4 and a molecular weight of 432.56 g/mol. Its IUPAC name is 8-benzoyl-5-methoxy-2,2-dimethyl-3,6,6-tris(prop-2-enyl)-3,4-dihydrochromen-7-one.
| Compound Name | 8-benzoyl-5-methoxy-2,2-dimethyl-3,6,6-tris(prop-2-enyl)-3,4-dihydrochromen-7-one |
|---|---|
| PubChem CID | 73441611 |
| Molecular Formula | C28H32O4 |
| Molecular Weight | 432.56 g/mol |
| Exact Mass | 432.23 |
| IUPAC Name | 8-benzoyl-5-methoxy-2,2-dimethyl-3,6,6-tris(prop-2-enyl)-3,4-dihydrochromen-7-one |
| SMILES | C=CCC1CC2=C(OC)C(CC=C)(CC=C)C(=O)C(C(=O)c3ccccc3)=C2OC1(C)C |
| InChI | InChI=1S/C28H32O4/c1-7-13-20-18-21-24(32-27(20,4)5)22(23(29)19-14-11-10-12-15-19)25(30)28(16-8-2,17-9-3)26(21)31-6/h7-12,14-15,20H,1-3,13,16-18H2,4-6H3 |
| InChIKey | YYMLGTVQFFGHSU-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.56 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|