About 6-(7H-pyrrolo[2,3-d]pyrimidin-4-ylamino)-3H-1,3-benzothiazol-2-one
6-(7H-pyrrolo[2,3-d]pyrimidin-4-ylamino)-3H-1,3-benzothiazol-2-one (PubChem CID 73442185) has the molecular formula C13H9N5OS
and a molecular weight of 283.32 g/mol. Its IUPAC name is 6-(7H-pyrrolo[2,3-d]pyrimidin-4-ylamino)-3H-1,3-benzothiazol-2-one.
Molecular Properties
| Compound Name | 6-(7H-pyrrolo[2,3-d]pyrimidin-4-ylamino)-3H-1,3-benzothiazol-2-one |
| PubChem CID | 73442185 |
| Molecular Formula | C13H9N5OS |
| Molecular Weight | 283.32 g/mol |
| Exact Mass | 283.05 |
| IUPAC Name | 6-(7H-pyrrolo[2,3-d]pyrimidin-4-ylamino)-3H-1,3-benzothiazol-2-one |
| SMILES | O=c1[nH]c2ccc(Nc3ncnc4[nH]ccc34)cc2s1 |
| InChI | InChI=1S/C13H9N5OS/c19-13-18-9-2-1-7(5-10(9)20-13)17-12-8-3-4-14-11(8)15-6-16-12/h1-6H,(H,18,19)(H2,14,15,16,17) |
| InChIKey | DVTFMUPXGWXHFP-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.32 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-(7H-pyrrolo[2,3-d]pyrimidin-4-ylamino)-3H-1,3-benzothiazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(7H-pyrrolo[2,3-d]pyrimidin-4-ylamino)-3H-1,3-benzothiazol-2-one?
The IUPAC name of 6-(7H-pyrrolo[2,3-d]pyrimidin-4-ylamino)-3H-1,3-benzothiazol-2-one (CID 73442185) is 6-(7H-pyrrolo[2,3-d]pyrimidin-4-ylamino)-3H-1,3-benzothiazol-2-one.
What is the SMILES notation for 6-(7H-pyrrolo[2,3-d]pyrimidin-4-ylamino)-3H-1,3-benzothiazol-2-one?
The canonical SMILES for 6-(7H-pyrrolo[2,3-d]pyrimidin-4-ylamino)-3H-1,3-benzothiazol-2-one is O=c1[nH]c2ccc(Nc3ncnc4[nH]ccc34)cc2s1.
What is the InChIKey of 6-(7H-pyrrolo[2,3-d]pyrimidin-4-ylamino)-3H-1,3-benzothiazol-2-one?
The InChIKey is DVTFMUPXGWXHFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9N5OS/c19-13-18-9-2-1-7(5-10(9)20-13)17-12-8-3-4-14-11(8)15-6-16-12/h1-6H,(H,18,19)(H2,14,15,16,17).
What are the key properties of 6-(7H-pyrrolo[2,3-d]pyrimidin-4-ylamino)-3H-1,3-benzothiazol-2-one?
6-(7H-pyrrolo[2,3-d]pyrimidin-4-ylamino)-3H-1,3-benzothiazol-2-one has a molecular weight of 283.32 g/mol, XLogP of 2.60, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(7H-pyrrolo[2,3-d]pyrimidin-4-ylamino)-3H-1,3-benzothiazol-2-one is sourced from PubChem (CID 73442185), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).