C27H26F6N4O3 — CID 73442310
(2S,3R)-2-[(3,3-difluorocyclobutyl)methyl]-N'-[(3S)-9-fluoro-2-oxo-5-phenyl-1,3-dihydro-1,4-benzodiazepin-3-yl]-3-(3,3,3-trifluoropropyl)butanediamide (PubChem CID 73442310) has the molecular formula C27H26F6N4O3 and a molecular weight of 568.52 g/mol. Its IUPAC name is (2S,3R)-2-[(3,3-difluorocyclobutyl)methyl]-N'-[(3S)-9-fluoro-2-oxo-5-phenyl-1,3-dihydro-1,4-benzodiazepin-3-yl]-3-(3,3,3-trifluoropropyl)butanediamide.
| Compound Name | (2S,3R)-2-[(3,3-difluorocyclobutyl)methyl]-N'-[(3S)-9-fluoro-2-oxo-5-phenyl-1,3-dihydro-1,4-benzodiazepin-3-yl]-3-(3,3,3-trifluoropropyl)butanediamide |
|---|---|
| PubChem CID | 73442310 |
| Molecular Formula | C27H26F6N4O3 |
| Molecular Weight | 568.52 g/mol |
| Exact Mass | 568.19 |
| IUPAC Name | (2S,3R)-2-[(3,3-difluorocyclobutyl)methyl]-N'-[(3S)-9-fluoro-2-oxo-5-phenyl-1,3-dihydro-1,4-benzodiazepin-3-yl]-3-(3,3,3-trifluoropropyl)butanediamide |
| SMILES | NC(=O)[C@@H](CC1CC(F)(F)C1)[C@@H](CCC(F)(F)F)C(=O)N[C@H]1N=C(c2ccccc2)c2cccc(F)c2NC1=O |
| InChI | InChI=1S/C27H26F6N4O3/c28-19-8-4-7-17-20(15-5-2-1-3-6-15)35-23(25(40)36-21(17)19)37-24(39)16(9-10-27(31,32)33)18(22(34)38)11-14-12-26(29,30)13-14/h1-8,14,16,18,23H,9-13H2,(H2,34,38)(H,36,40)(H,37,39)/t16-,18+,23-/m1/s1 |
| InChIKey | OYVNZMZRYVSNQD-WLENULPWSA-N |
| XLogP | 4.55 |
| TPSA | 113.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.52 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |