C29H31F5N4O4 — CID 73442311
(2S,3R)-2-(4,4-difluorocyclohexyl)-N'-[(3S)-9-methoxy-2-oxo-5-phenyl-1,3-dihydro-1,4-benzodiazepin-3-yl]-3-(3,3,3-trifluoropropyl)butanediamide (PubChem CID 73442311) has the molecular formula C29H31F5N4O4 and a molecular weight of 594.58 g/mol. Its IUPAC name is (2S,3R)-2-(4,4-difluorocyclohexyl)-N'-[(3S)-9-methoxy-2-oxo-5-phenyl-1,3-dihydro-1,4-benzodiazepin-3-yl]-3-(3,3,3-trifluoropropyl)butanediamide.
| Compound Name | (2S,3R)-2-(4,4-difluorocyclohexyl)-N'-[(3S)-9-methoxy-2-oxo-5-phenyl-1,3-dihydro-1,4-benzodiazepin-3-yl]-3-(3,3,3-trifluoropropyl)butanediamide |
|---|---|
| PubChem CID | 73442311 |
| Molecular Formula | C29H31F5N4O4 |
| Molecular Weight | 594.58 g/mol |
| Exact Mass | 594.23 |
| IUPAC Name | (2S,3R)-2-(4,4-difluorocyclohexyl)-N'-[(3S)-9-methoxy-2-oxo-5-phenyl-1,3-dihydro-1,4-benzodiazepin-3-yl]-3-(3,3,3-trifluoropropyl)butanediamide |
| SMILES | COc1cccc2c1NC(=O)[C@@H](NC(=O)[C@H](CCC(F)(F)F)[C@@H](C(N)=O)C1CCC(F)(F)CC1)N=C2c1ccccc1 |
| InChI | InChI=1S/C29H31F5N4O4/c1-42-20-9-5-8-19-22(17-6-3-2-4-7-17)36-25(27(41)37-23(19)20)38-26(40)18(12-15-29(32,33)34)21(24(35)39)16-10-13-28(30,31)14-11-16/h2-9,16,18,21,25H,10-15H2,1H3,(H2,35,39)(H,37,41)(H,38,40)/t18-,21+,25-/m1/s1 |
| InChIKey | GPSAOZZYKLGLJH-DHTSOJEISA-N |
| XLogP | 4.81 |
| TPSA | 122.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.58 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |