About 2,3-dichloro-N-[2-(4,4-difluoropiperidin-1-yl)-2-(4-fluorophenyl)ethyl]benzamide
2,3-dichloro-N-[2-(4,4-difluoropiperidin-1-yl)-2-(4-fluorophenyl)ethyl]benzamide (PubChem CID 73442861) has the molecular formula C20H19Cl2F3N2O
and a molecular weight of 431.29 g/mol. Its IUPAC name is 2,3-dichloro-N-[2-(4,4-difluoropiperidin-1-yl)-2-(4-fluorophenyl)ethyl]benzamide.
Molecular Properties
| Compound Name | 2,3-dichloro-N-[2-(4,4-difluoropiperidin-1-yl)-2-(4-fluorophenyl)ethyl]benzamide |
| PubChem CID | 73442861 |
| Molecular Formula | C20H19Cl2F3N2O |
| Molecular Weight | 431.29 g/mol |
| Exact Mass | 430.08 |
| IUPAC Name | 2,3-dichloro-N-[2-(4,4-difluoropiperidin-1-yl)-2-(4-fluorophenyl)ethyl]benzamide |
| SMILES | O=C(NCC(c1ccc(F)cc1)N1CCC(F)(F)CC1)c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C20H19Cl2F3N2O/c21-16-3-1-2-15(18(16)22)19(28)26-12-17(13-4-6-14(23)7-5-13)27-10-8-20(24,25)9-11-27/h1-7,17H,8-12H2,(H,26,28) |
| InChIKey | ASROAJWWBQODIW-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 431.29 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,3-dichloro-N-[2-(4,4-difluoropiperidin-1-yl)-2-(4-fluorophenyl)ethyl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dichloro-N-[2-(4,4-difluoropiperidin-1-yl)-2-(4-fluorophenyl)ethyl]benzamide?
The IUPAC name of 2,3-dichloro-N-[2-(4,4-difluoropiperidin-1-yl)-2-(4-fluorophenyl)ethyl]benzamide (CID 73442861) is 2,3-dichloro-N-[2-(4,4-difluoropiperidin-1-yl)-2-(4-fluorophenyl)ethyl]benzamide.
What is the SMILES notation for 2,3-dichloro-N-[2-(4,4-difluoropiperidin-1-yl)-2-(4-fluorophenyl)ethyl]benzamide?
The canonical SMILES for 2,3-dichloro-N-[2-(4,4-difluoropiperidin-1-yl)-2-(4-fluorophenyl)ethyl]benzamide is O=C(NCC(c1ccc(F)cc1)N1CCC(F)(F)CC1)c1cccc(Cl)c1Cl.
What is the InChIKey of 2,3-dichloro-N-[2-(4,4-difluoropiperidin-1-yl)-2-(4-fluorophenyl)ethyl]benzamide?
The InChIKey is ASROAJWWBQODIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19Cl2F3N2O/c21-16-3-1-2-15(18(16)22)19(28)26-12-17(13-4-6-14(23)7-5-13)27-10-8-20(24,25)9-11-27/h1-7,17H,8-12H2,(H,26,28).
What are the key properties of 2,3-dichloro-N-[2-(4,4-difluoropiperidin-1-yl)-2-(4-fluorophenyl)ethyl]benzamide?
2,3-dichloro-N-[2-(4,4-difluoropiperidin-1-yl)-2-(4-fluorophenyl)ethyl]benzamide has a molecular weight of 431.29 g/mol, XLogP of 5.33, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dichloro-N-[2-(4,4-difluoropiperidin-1-yl)-2-(4-fluorophenyl)ethyl]benzamide is sourced from PubChem (CID 73442861), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).