C21H17Cl2N3O2S — CID 73444548
5-[[4-(1-butyl-5,6-dichlorobenzimidazol-2-yl)phenyl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 73444548) has the molecular formula C21H17Cl2N3O2S and a molecular weight of 446.36 g/mol. Its IUPAC name is 5-[[4-(1-butyl-5,6-dichlorobenzimidazol-2-yl)phenyl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[4-(1-butyl-5,6-dichlorobenzimidazol-2-yl)phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 73444548 |
| Molecular Formula | C21H17Cl2N3O2S |
| Molecular Weight | 446.36 g/mol |
| Exact Mass | 445.04 |
| IUPAC Name | 5-[[4-(1-butyl-5,6-dichlorobenzimidazol-2-yl)phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | CCCCn1c(-c2ccc(C=C3SC(=O)NC3=O)cc2)nc2cc(Cl)c(Cl)cc21 |
| InChI | InChI=1S/C21H17Cl2N3O2S/c1-2-3-8-26-17-11-15(23)14(22)10-16(17)24-19(26)13-6-4-12(5-7-13)9-18-20(27)25-21(28)29-18/h4-7,9-11H,2-3,8H2,1H3,(H,25,27,28) |
| InChIKey | WCPNJWCGFGVJGR-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.36 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|