C7H8NO3S2- — CID 7344580
3-[(5R)-5-methyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoate (PubChem CID 7344580) has the molecular formula C7H8NO3S2- and a molecular weight of 218.28 g/mol. Its IUPAC name is 3-[(5R)-5-methyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoate.
| Compound Name | 3-[(5R)-5-methyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoate |
|---|---|
| PubChem CID | 7344580 |
| Molecular Formula | C7H8NO3S2- |
| Molecular Weight | 218.28 g/mol |
| Exact Mass | 218.00 |
| IUPAC Name | 3-[(5R)-5-methyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoate |
| SMILES | C[C@H]1SC(=S)N(CCC(=O)[O-])C1=O |
| InChI | InChI=1S/C7H9NO3S2/c1-4-6(11)8(7(12)13-4)3-2-5(9)10/h4H,2-3H2,1H3,(H,9,10)/p-1/t4-/m1/s1 |
| InChIKey | AXJBXMCGSULBJF-SCSAIBSYSA-M |
| XLogP | -0.62 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.28 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'rhod_sat_A(33)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|