C26H36N2O2 — CID 73446135
2,6-diethyl-2,3,6-trimethyl-N,1-bis(phenylmethoxy)piperidin-4-imine (PubChem CID 73446135) has the molecular formula C26H36N2O2 and a molecular weight of 408.59 g/mol. Its IUPAC name is 2,6-diethyl-2,3,6-trimethyl-N,1-bis(phenylmethoxy)piperidin-4-imine.
| Compound Name | 2,6-diethyl-2,3,6-trimethyl-N,1-bis(phenylmethoxy)piperidin-4-imine |
|---|---|
| PubChem CID | 73446135 |
| Molecular Formula | C26H36N2O2 |
| Molecular Weight | 408.59 g/mol |
| Exact Mass | 408.28 |
| IUPAC Name | 2,6-diethyl-2,3,6-trimethyl-N,1-bis(phenylmethoxy)piperidin-4-imine |
| SMILES | CCC1(C)CC(=NOCc2ccccc2)C(C)C(C)(CC)N1OCc1ccccc1 |
| InChI | InChI=1S/C26H36N2O2/c1-6-25(4)18-24(27-29-19-22-14-10-8-11-15-22)21(3)26(5,7-2)28(25)30-20-23-16-12-9-13-17-23/h8-17,21H,6-7,18-20H2,1-5H3 |
| InChIKey | VQQBBKBPTIRHCA-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.59 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|