About N-[4-[(4,6-dimethylpyrimidin-2-yl)amino]phenyl]acetamide
N-[4-[(4,6-dimethylpyrimidin-2-yl)amino]phenyl]acetamide (PubChem CID 734481) has the molecular formula C14H16N4O
and a molecular weight of 256.31 g/mol. Its IUPAC name is N-[4-[(4,6-dimethylpyrimidin-2-yl)amino]phenyl]acetamide.
Molecular Properties
| Compound Name | N-[4-[(4,6-dimethylpyrimidin-2-yl)amino]phenyl]acetamide |
| PubChem CID | 734481 |
| Molecular Formula | C14H16N4O |
| Molecular Weight | 256.31 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | N-[4-[(4,6-dimethylpyrimidin-2-yl)amino]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(Nc2nc(C)cc(C)n2)cc1 |
| InChI | InChI=1S/C14H16N4O/c1-9-8-10(2)16-14(15-9)18-13-6-4-12(5-7-13)17-11(3)19/h4-8H,1-3H3,(H,17,19)(H,15,16,18) |
| InChIKey | ZEPSDPGTQUMXBG-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.31 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[4-[(4,6-dimethylpyrimidin-2-yl)amino]phenyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-[(4,6-dimethylpyrimidin-2-yl)amino]phenyl]acetamide?
The IUPAC name of N-[4-[(4,6-dimethylpyrimidin-2-yl)amino]phenyl]acetamide (CID 734481) is N-[4-[(4,6-dimethylpyrimidin-2-yl)amino]phenyl]acetamide.
What is the SMILES notation for N-[4-[(4,6-dimethylpyrimidin-2-yl)amino]phenyl]acetamide?
The canonical SMILES for N-[4-[(4,6-dimethylpyrimidin-2-yl)amino]phenyl]acetamide is CC(=O)Nc1ccc(Nc2nc(C)cc(C)n2)cc1.
What is the InChIKey of N-[4-[(4,6-dimethylpyrimidin-2-yl)amino]phenyl]acetamide?
The InChIKey is ZEPSDPGTQUMXBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16N4O/c1-9-8-10(2)16-14(15-9)18-13-6-4-12(5-7-13)17-11(3)19/h4-8H,1-3H3,(H,17,19)(H,15,16,18).
What are the key properties of N-[4-[(4,6-dimethylpyrimidin-2-yl)amino]phenyl]acetamide?
N-[4-[(4,6-dimethylpyrimidin-2-yl)amino]phenyl]acetamide has a molecular weight of 256.31 g/mol, XLogP of 2.80, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-[(4,6-dimethylpyrimidin-2-yl)amino]phenyl]acetamide is sourced from PubChem (CID 734481), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).