C19H20ClN6O3+ — CID 73448746
3-(4-chlorophenyl)-7,9-dimethyl-1-(3-oxobutan-2-yl)-4,5a-dihydropurino[8,7-c][1,2,4]triazin-5-ium-6,8-dione (PubChem CID 73448746) has the molecular formula C19H20ClN6O3+ and a molecular weight of 415.86 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-7,9-dimethyl-1-(3-oxobutan-2-yl)-4,5a-dihydropurino[8,7-c][1,2,4]triazin-5-ium-6,8-dione.
| Compound Name | 3-(4-chlorophenyl)-7,9-dimethyl-1-(3-oxobutan-2-yl)-4,5a-dihydropurino[8,7-c][1,2,4]triazin-5-ium-6,8-dione |
|---|---|
| PubChem CID | 73448746 |
| Molecular Formula | C19H20ClN6O3+ |
| Molecular Weight | 415.86 g/mol |
| Exact Mass | 415.13 |
| IUPAC Name | 3-(4-chlorophenyl)-7,9-dimethyl-1-(3-oxobutan-2-yl)-4,5a-dihydropurino[8,7-c][1,2,4]triazin-5-ium-6,8-dione |
| SMILES | CC(=O)C(C)N1N=C(c2ccc(Cl)cc2)C[N+]2=C1N=C1C2C(=O)N(C)C(=O)N1C |
| InChI | InChI=1S/C19H20ClN6O3/c1-10(11(2)27)26-18-21-16-15(17(28)24(4)19(29)23(16)3)25(18)9-14(22-26)12-5-7-13(20)8-6-12/h5-8,10,15H,9H2,1-4H3/q+1 |
| InChIKey | MXJJAHSFOJQZHH-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 88.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.86 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|