About 2-(3-ethyl-3-methyl-2,4-dihydroisoquinolin-1-ylidene)-N-methylacetamide;hydrochloride
2-(3-ethyl-3-methyl-2,4-dihydroisoquinolin-1-ylidene)-N-methylacetamide;hydrochloride (PubChem CID 73449358) has the molecular formula C15H21ClN2O
and a molecular weight of 280.80 g/mol. Its IUPAC name is 2-(3-ethyl-3-methyl-2,4-dihydroisoquinolin-1-ylidene)-N-methylacetamide;hydrochloride.
Molecular Properties
| Compound Name | 2-(3-ethyl-3-methyl-2,4-dihydroisoquinolin-1-ylidene)-N-methylacetamide;hydrochloride |
| PubChem CID | 73449358 |
| Molecular Formula | C15H21ClN2O |
| Molecular Weight | 280.80 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | 2-(3-ethyl-3-methyl-2,4-dihydroisoquinolin-1-ylidene)-N-methylacetamide;hydrochloride |
| SMILES | CCC1(C)Cc2ccccc2C(=CC(=O)NC)N1.Cl |
| InChI | InChI=1S/C15H20N2O.ClH/c1-4-15(2)10-11-7-5-6-8-12(11)13(17-15)9-14(18)16-3;/h5-9,17H,4,10H2,1-3H3,(H,16,18);1H |
| InChIKey | NRQYGHKBQRLANC-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.80 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-ethyl-3-methyl-2,4-dihydroisoquinolin-1-ylidene)-N-methylacetamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-ethyl-3-methyl-2,4-dihydroisoquinolin-1-ylidene)-N-methylacetamide;hydrochloride?
The IUPAC name of 2-(3-ethyl-3-methyl-2,4-dihydroisoquinolin-1-ylidene)-N-methylacetamide;hydrochloride (CID 73449358) is 2-(3-ethyl-3-methyl-2,4-dihydroisoquinolin-1-ylidene)-N-methylacetamide;hydrochloride.
What is the SMILES notation for 2-(3-ethyl-3-methyl-2,4-dihydroisoquinolin-1-ylidene)-N-methylacetamide;hydrochloride?
The canonical SMILES for 2-(3-ethyl-3-methyl-2,4-dihydroisoquinolin-1-ylidene)-N-methylacetamide;hydrochloride is CCC1(C)Cc2ccccc2C(=CC(=O)NC)N1.Cl.
What is the InChIKey of 2-(3-ethyl-3-methyl-2,4-dihydroisoquinolin-1-ylidene)-N-methylacetamide;hydrochloride?
The InChIKey is NRQYGHKBQRLANC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20N2O.ClH/c1-4-15(2)10-11-7-5-6-8-12(11)13(17-15)9-14(18)16-3;/h5-9,17H,4,10H2,1-3H3,(H,16,18);1H.
What are the key properties of 2-(3-ethyl-3-methyl-2,4-dihydroisoquinolin-1-ylidene)-N-methylacetamide;hydrochloride?
2-(3-ethyl-3-methyl-2,4-dihydroisoquinolin-1-ylidene)-N-methylacetamide;hydrochloride has a molecular weight of 280.80 g/mol, XLogP of 2.51, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-ethyl-3-methyl-2,4-dihydroisoquinolin-1-ylidene)-N-methylacetamide;hydrochloride is sourced from PubChem (CID 73449358), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).